C9H11Cl3N2O3 — CID 101340863
2,2,2-trichloroethyl 2-cyano-3-oxo-3-(propan-2-ylamino)propanoate (PubChem CID 101340863) has the molecular formula C9H11Cl3N2O3 and a molecular weight of 301.56 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-cyano-3-oxo-3-(propan-2-ylamino)propanoate.
| Compound Name | 2,2,2-trichloroethyl 2-cyano-3-oxo-3-(propan-2-ylamino)propanoate |
|---|---|
| PubChem CID | 101340863 |
| Molecular Formula | C9H11Cl3N2O3 |
| Molecular Weight | 301.56 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 2,2,2-trichloroethyl 2-cyano-3-oxo-3-(propan-2-ylamino)propanoate |
| SMILES | CC(C)NC(=O)C(C#N)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H11Cl3N2O3/c1-5(2)14-7(15)6(3-13)8(16)17-4-9(10,11)12/h5-6H,4H2,1-2H3,(H,14,15) |
| InChIKey | QMGAPWHZBYJJCP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.56 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|