C14H18N2O2S — CID 98200944
(2S,4S)-2-cyano-4-methyl-3-oxo-N-propan-2-yl-5-thiophen-2-ylpentanamide (PubChem CID 98200944) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is (2S,4S)-2-cyano-4-methyl-3-oxo-N-propan-2-yl-5-thiophen-2-ylpentanamide.
| Compound Name | (2S,4S)-2-cyano-4-methyl-3-oxo-N-propan-2-yl-5-thiophen-2-ylpentanamide |
|---|---|
| PubChem CID | 98200944 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (2S,4S)-2-cyano-4-methyl-3-oxo-N-propan-2-yl-5-thiophen-2-ylpentanamide |
| SMILES | CC(C)NC(=O)[C@@H](C#N)C(=O)[C@@H](C)Cc1cccs1 |
| InChI | InChI=1S/C14H18N2O2S/c1-9(2)16-14(18)12(8-15)13(17)10(3)7-11-5-4-6-19-11/h4-6,9-10,12H,7H2,1-3H3,(H,16,18)/t10-,12-/m0/s1 |
| InChIKey | DOSRVIDZYZKBCS-JQWIXIFHSA-N |
| XLogP | 2.16 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|