C12H21ClN2OS — CID 119722730
2-methyl-3-(methylamino)-N-(1-thiophen-2-ylpropan-2-yl)propanamide;hydrochloride (PubChem CID 119722730) has the molecular formula C12H21ClN2OS and a molecular weight of 276.83 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-N-(1-thiophen-2-ylpropan-2-yl)propanamide;hydrochloride.
| Compound Name | 2-methyl-3-(methylamino)-N-(1-thiophen-2-ylpropan-2-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119722730 |
| Molecular Formula | C12H21ClN2OS |
| Molecular Weight | 276.83 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-methyl-3-(methylamino)-N-(1-thiophen-2-ylpropan-2-yl)propanamide;hydrochloride |
| SMILES | CNCC(C)C(=O)NC(C)Cc1cccs1.Cl |
| InChI | InChI=1S/C12H20N2OS.ClH/c1-9(8-13-3)12(15)14-10(2)7-11-5-4-6-16-11;/h4-6,9-10,13H,7-8H2,1-3H3,(H,14,15);1H |
| InChIKey | DTSRRKBOGROEAU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.83 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |