C13H16N2OS2 — CID 45497246
1-(thiophen-2-ylmethyl)-3-(1-thiophen-2-ylpropan-2-yl)urea (PubChem CID 45497246) has the molecular formula C13H16N2OS2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 1-(thiophen-2-ylmethyl)-3-(1-thiophen-2-ylpropan-2-yl)urea.
| Compound Name | 1-(thiophen-2-ylmethyl)-3-(1-thiophen-2-ylpropan-2-yl)urea |
|---|---|
| PubChem CID | 45497246 |
| Molecular Formula | C13H16N2OS2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 1-(thiophen-2-ylmethyl)-3-(1-thiophen-2-ylpropan-2-yl)urea |
| SMILES | CC(Cc1cccs1)NC(=O)NCc1cccs1 |
| InChI | InChI=1S/C13H16N2OS2/c1-10(8-11-4-2-6-17-11)15-13(16)14-9-12-5-3-7-18-12/h2-7,10H,8-9H2,1H3,(H2,14,15,16) |
| InChIKey | NYJHISWJMHGFDV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |