C10H16N2O2S — CID 94744411
1-[(2R)-1-methoxypropan-2-yl]-3-(thiophen-2-ylmethyl)urea (PubChem CID 94744411) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 1-[(2R)-1-methoxypropan-2-yl]-3-(thiophen-2-ylmethyl)urea.
| Compound Name | 1-[(2R)-1-methoxypropan-2-yl]-3-(thiophen-2-ylmethyl)urea |
|---|---|
| PubChem CID | 94744411 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 1-[(2R)-1-methoxypropan-2-yl]-3-(thiophen-2-ylmethyl)urea |
| SMILES | COC[C@@H](C)NC(=O)NCc1cccs1 |
| InChI | InChI=1S/C10H16N2O2S/c1-8(7-14-2)12-10(13)11-6-9-4-3-5-15-9/h3-5,8H,6-7H2,1-2H3,(H2,11,12,13)/t8-/m1/s1 |
| InChIKey | DIHITWQHLCEMAB-MRVPVSSYSA-N |
| XLogP | 1.58 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |