C17H22N2O3S — CID 87039146
1-[(2,4-dimethoxyphenyl)methyl]-3-(1-thiophen-2-ylpropan-2-yl)urea (PubChem CID 87039146) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-3-(1-thiophen-2-ylpropan-2-yl)urea.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-(1-thiophen-2-ylpropan-2-yl)urea |
|---|---|
| PubChem CID | 87039146 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-(1-thiophen-2-ylpropan-2-yl)urea |
| SMILES | COc1ccc(CNC(=O)NC(C)Cc2cccs2)c(OC)c1 |
| InChI | InChI=1S/C17H22N2O3S/c1-12(9-15-5-4-8-23-15)19-17(20)18-11-13-6-7-14(21-2)10-16(13)22-3/h4-8,10,12H,9,11H2,1-3H3,(H2,18,19,20) |
| InChIKey | WXFPUMJAWCGNDU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |