C14H18N2O4S — CID 76994566
2,3-dimethyl-4-oxo-4-(1-thiophen-2-ylpropan-2-ylcarbamoylamino)but-2-enoic acid (PubChem CID 76994566) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2,3-dimethyl-4-oxo-4-(1-thiophen-2-ylpropan-2-ylcarbamoylamino)but-2-enoic acid.
| Compound Name | 2,3-dimethyl-4-oxo-4-(1-thiophen-2-ylpropan-2-ylcarbamoylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 76994566 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2,3-dimethyl-4-oxo-4-(1-thiophen-2-ylpropan-2-ylcarbamoylamino)but-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C)C(=O)NC(=O)NC(C)Cc1cccs1 |
| InChI | InChI=1S/C14H18N2O4S/c1-8(7-11-5-4-6-21-11)15-14(20)16-12(17)9(2)10(3)13(18)19/h4-6,8H,7H2,1-3H3,(H,18,19)(H2,15,16,17,20) |
| InChIKey | AANRLDYSQMFXEU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|