C15H24Cl3NO4 — CID 91741037
2-methylpropyl 2-cyclohexyl-2-(2,2,2-trichloroethoxycarbonylamino)acetate (PubChem CID 91741037) has the molecular formula C15H24Cl3NO4 and a molecular weight of 388.72 g/mol. Its IUPAC name is 2-methylpropyl 2-cyclohexyl-2-(2,2,2-trichloroethoxycarbonylamino)acetate.
| Compound Name | 2-methylpropyl 2-cyclohexyl-2-(2,2,2-trichloroethoxycarbonylamino)acetate |
|---|---|
| PubChem CID | 91741037 |
| Molecular Formula | C15H24Cl3NO4 |
| Molecular Weight | 388.72 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 2-methylpropyl 2-cyclohexyl-2-(2,2,2-trichloroethoxycarbonylamino)acetate |
| SMILES | CC(C)COC(=O)C(NC(=O)OCC(Cl)(Cl)Cl)C1CCCCC1 |
| InChI | InChI=1S/C15H24Cl3NO4/c1-10(2)8-22-13(20)12(11-6-4-3-5-7-11)19-14(21)23-9-15(16,17)18/h10-12H,3-9H2,1-2H3,(H,19,21) |
| InChIKey | DIJJYKUPSURZAL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.72 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|