C13H25NO4 — CID 142110329
2-methylpropyl N-(1-cyclohexyl-2,2-dihydroxyethyl)carbamate (PubChem CID 142110329) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is 2-methylpropyl N-(1-cyclohexyl-2,2-dihydroxyethyl)carbamate.
| Compound Name | 2-methylpropyl N-(1-cyclohexyl-2,2-dihydroxyethyl)carbamate |
|---|---|
| PubChem CID | 142110329 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 2-methylpropyl N-(1-cyclohexyl-2,2-dihydroxyethyl)carbamate |
| SMILES | CC(C)COC(=O)NC(C(O)O)C1CCCCC1 |
| InChI | InChI=1S/C13H25NO4/c1-9(2)8-18-13(17)14-11(12(15)16)10-6-4-3-5-7-10/h9-12,15-16H,3-8H2,1-2H3,(H,14,17) |
| InChIKey | RDHYAINONAYCMD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|