C16H17ClN2O2 — CID 98510073
(E,2R)-5-(2-chlorophenyl)-2-cyano-3-oxo-N-propan-2-ylhex-4-enamide (PubChem CID 98510073) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is (E,2R)-5-(2-chlorophenyl)-2-cyano-3-oxo-N-propan-2-ylhex-4-enamide.
| Compound Name | (E,2R)-5-(2-chlorophenyl)-2-cyano-3-oxo-N-propan-2-ylhex-4-enamide |
|---|---|
| PubChem CID | 98510073 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (E,2R)-5-(2-chlorophenyl)-2-cyano-3-oxo-N-propan-2-ylhex-4-enamide |
| SMILES | C/C(=C\C(=O)[C@@H](C#N)C(=O)NC(C)C)c1ccccc1Cl |
| InChI | InChI=1S/C16H17ClN2O2/c1-10(2)19-16(21)13(9-18)15(20)8-11(3)12-6-4-5-7-14(12)17/h4-8,10,13H,1-3H3,(H,19,21)/b11-8+/t13-/m1/s1 |
| InChIKey | PDGJTVBEWOVCLS-RUNBWSAHSA-N |
| XLogP | 2.98 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|