C17H26OSSi — CID 101124004
(3R,4S)-3-(phenylsulfanylmethyl)-1-trimethylsilylhept-1-yn-4-ol (PubChem CID 101124004) has the molecular formula C17H26OSSi and a molecular weight of 306.55 g/mol. Its IUPAC name is (3R,4S)-3-(phenylsulfanylmethyl)-1-trimethylsilylhept-1-yn-4-ol.
| Compound Name | (3R,4S)-3-(phenylsulfanylmethyl)-1-trimethylsilylhept-1-yn-4-ol |
|---|---|
| PubChem CID | 101124004 |
| Molecular Formula | C17H26OSSi |
| Molecular Weight | 306.55 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (3R,4S)-3-(phenylsulfanylmethyl)-1-trimethylsilylhept-1-yn-4-ol |
| SMILES | CCC[C@H](O)[C@@H](C#C[Si](C)(C)C)CSc1ccccc1 |
| InChI | InChI=1S/C17H26OSSi/c1-5-9-17(18)15(12-13-20(2,3)4)14-19-16-10-7-6-8-11-16/h6-8,10-11,15,17-18H,5,9,14H2,1-4H3/t15-,17-/m0/s1 |
| InChIKey | RWLLRTPXRWRSPE-RDJZCZTQSA-N |
| XLogP | 4.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|