C16H19NOS2 — CID 54276659
(3R)-3-amino-1,4-bis(phenylsulfanyl)butan-2-ol (PubChem CID 54276659) has the molecular formula C16H19NOS2 and a molecular weight of 305.47 g/mol. Its IUPAC name is (3R)-3-amino-1,4-bis(phenylsulfanyl)butan-2-ol.
| Compound Name | (3R)-3-amino-1,4-bis(phenylsulfanyl)butan-2-ol |
|---|---|
| PubChem CID | 54276659 |
| Molecular Formula | C16H19NOS2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (3R)-3-amino-1,4-bis(phenylsulfanyl)butan-2-ol |
| SMILES | N[C@@H](CSc1ccccc1)C(O)CSc1ccccc1 |
| InChI | InChI=1S/C16H19NOS2/c17-15(11-19-13-7-3-1-4-8-13)16(18)12-20-14-9-5-2-6-10-14/h1-10,15-16,18H,11-12,17H2/t15-,16?/m0/s1 |
| InChIKey | RNWPJARWNFMEDC-VYRBHSGPSA-N |
| XLogP | 3.26 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |