C17H28O2S — CID 14120606
(2R,3R,4S)-2,4,7-trimethyl-4-phenylsulfanyloctane-1,3-diol (PubChem CID 14120606) has the molecular formula C17H28O2S and a molecular weight of 296.48 g/mol. Its IUPAC name is (2R,3R,4S)-2,4,7-trimethyl-4-phenylsulfanyloctane-1,3-diol.
| Compound Name | (2R,3R,4S)-2,4,7-trimethyl-4-phenylsulfanyloctane-1,3-diol |
|---|---|
| PubChem CID | 14120606 |
| Molecular Formula | C17H28O2S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (2R,3R,4S)-2,4,7-trimethyl-4-phenylsulfanyloctane-1,3-diol |
| SMILES | CC(C)CC[C@](C)(Sc1ccccc1)[C@H](O)[C@H](C)CO |
| InChI | InChI=1S/C17H28O2S/c1-13(2)10-11-17(4,16(19)14(3)12-18)20-15-8-6-5-7-9-15/h5-9,13-14,16,18-19H,10-12H2,1-4H3/t14-,16-,17+/m1/s1 |
| InChIKey | IYDAYASXMIIMQJ-OIISXLGYSA-N |
| XLogP | 3.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |