C21H28OS2 — CID 13452343
7-methyl-4,4-bis(phenylsulfanyl)octan-3-ol (PubChem CID 13452343) has the molecular formula C21H28OS2 and a molecular weight of 360.59 g/mol. Its IUPAC name is 7-methyl-4,4-bis(phenylsulfanyl)octan-3-ol.
| Compound Name | 7-methyl-4,4-bis(phenylsulfanyl)octan-3-ol |
|---|---|
| PubChem CID | 13452343 |
| Molecular Formula | C21H28OS2 |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 7-methyl-4,4-bis(phenylsulfanyl)octan-3-ol |
| SMILES | CCC(O)C(CCC(C)C)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C21H28OS2/c1-4-20(22)21(16-15-17(2)3,23-18-11-7-5-8-12-18)24-19-13-9-6-10-14-19/h5-14,17,20,22H,4,15-16H2,1-3H3 |
| InChIKey | ARIROJSPYIRJTO-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|