C30H30O3S4 — CID 88758824
3-(1-hydroxypropan-2-yloxy)-1,1,1,2-tetrakis(phenylsulfanyl)propan-2-ol (PubChem CID 88758824) has the molecular formula C30H30O3S4 and a molecular weight of 566.84 g/mol. Its IUPAC name is 3-(1-hydroxypropan-2-yloxy)-1,1,1,2-tetrakis(phenylsulfanyl)propan-2-ol.
| Compound Name | 3-(1-hydroxypropan-2-yloxy)-1,1,1,2-tetrakis(phenylsulfanyl)propan-2-ol |
|---|---|
| PubChem CID | 88758824 |
| Molecular Formula | C30H30O3S4 |
| Molecular Weight | 566.84 g/mol |
| Exact Mass | 566.11 |
| IUPAC Name | 3-(1-hydroxypropan-2-yloxy)-1,1,1,2-tetrakis(phenylsulfanyl)propan-2-ol |
| SMILES | CC(CO)OCC(O)(Sc1ccccc1)C(Sc1ccccc1)(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C30H30O3S4/c1-24(22-31)33-23-29(32,34-25-14-6-2-7-15-25)30(35-26-16-8-3-9-17-26,36-27-18-10-4-11-19-27)37-28-20-12-5-13-21-28/h2-21,24,31-32H,22-23H2,1H3 |
| InChIKey | FVODCCNVMXDINB-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.84 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|