About benzene;ethane;2-phenoxypropan-1-ol
benzene;ethane;2-phenoxypropan-1-ol (PubChem CID 145115512) has the molecular formula C17H24O2
and a molecular weight of 260.38 g/mol. Its IUPAC name is benzene;ethane;2-phenoxypropan-1-ol.
Molecular Properties
| Compound Name | benzene;ethane;2-phenoxypropan-1-ol |
| PubChem CID | 145115512 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | benzene;ethane;2-phenoxypropan-1-ol |
| SMILES | CC.CC(CO)Oc1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C9H12O2.C6H6.C2H6/c1-8(7-10)11-9-5-3-2-4-6-9;1-2-4-6-5-3-1;1-2/h2-6,8,10H,7H2,1H3;1-6H;1-2H3 |
| InChIKey | UDEBHYQAEOSTDR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;ethane;2-phenoxypropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;ethane;2-phenoxypropan-1-ol?
The IUPAC name of benzene;ethane;2-phenoxypropan-1-ol (CID 145115512) is benzene;ethane;2-phenoxypropan-1-ol.
What is the SMILES notation for benzene;ethane;2-phenoxypropan-1-ol?
The canonical SMILES for benzene;ethane;2-phenoxypropan-1-ol is CC.CC(CO)Oc1ccccc1.c1ccccc1.
What is the InChIKey of benzene;ethane;2-phenoxypropan-1-ol?
The InChIKey is UDEBHYQAEOSTDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2.C6H6.C2H6/c1-8(7-10)11-9-5-3-2-4-6-9;1-2-4-6-5-3-1;1-2/h2-6,8,10H,7H2,1H3;1-6H;1-2H3.
What are the key properties of benzene;ethane;2-phenoxypropan-1-ol?
benzene;ethane;2-phenoxypropan-1-ol has a molecular weight of 260.38 g/mol, XLogP of 4.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;ethane;2-phenoxypropan-1-ol is sourced from PubChem (CID 145115512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).