C11H17NO — CID 15082323
N,N-dimethyl-2-phenoxypropan-1-amine (PubChem CID 15082323) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is N,N-dimethyl-2-phenoxypropan-1-amine.
| Compound Name | N,N-dimethyl-2-phenoxypropan-1-amine |
|---|---|
| PubChem CID | 15082323 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | N,N-dimethyl-2-phenoxypropan-1-amine |
| SMILES | CC(CN(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C11H17NO/c1-10(9-12(2)3)13-11-7-5-4-6-8-11/h4-8,10H,9H2,1-3H3 |
| InChIKey | RXWUDHRCIIFQQK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |