C11H18ClNO — CID 117066903
N,N-dimethyl-2-phenoxypropan-1-amine;hydrochloride (PubChem CID 117066903) has the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. Its IUPAC name is N,N-dimethyl-2-phenoxypropan-1-amine;hydrochloride.
| Compound Name | N,N-dimethyl-2-phenoxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 117066903 |
| Molecular Formula | C11H18ClNO |
| Molecular Weight | 215.72 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | N,N-dimethyl-2-phenoxypropan-1-amine;hydrochloride |
| SMILES | CC(CN(C)C)Oc1ccccc1.Cl |
| InChI | InChI=1S/C11H17NO.ClH/c1-10(9-12(2)3)13-11-7-5-4-6-8-11;/h4-8,10H,9H2,1-3H3;1H |
| InChIKey | PMEBVQFURPLGKT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.72 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |