C25H26N2O3 — CID 97301890
(2S)-N,N-dimethyl-2-[4-[(E)-2-nitro-1,2-diphenylethenyl]phenoxy]propan-1-amine (PubChem CID 97301890) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is (2S)-N,N-dimethyl-2-[4-[(E)-2-nitro-1,2-diphenylethenyl]phenoxy]propan-1-amine.
| Compound Name | (2S)-N,N-dimethyl-2-[4-[(E)-2-nitro-1,2-diphenylethenyl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 97301890 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | (2S)-N,N-dimethyl-2-[4-[(E)-2-nitro-1,2-diphenylethenyl]phenoxy]propan-1-amine |
| SMILES | C[C@@H](CN(C)C)Oc1ccc(/C(=C(\c2ccccc2)[N+](=O)[O-])c2ccccc2)cc1 |
| InChI | InChI=1S/C25H26N2O3/c1-19(18-26(2)3)30-23-16-14-21(15-17-23)24(20-10-6-4-7-11-20)25(27(28)29)22-12-8-5-9-13-22/h4-17,19H,18H2,1-3H3/b25-24+/t19-/m0/s1 |
| InChIKey | VOTIBLWBMGUNCK-ZFZZVZNFSA-N |
| XLogP | 5.21 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|