C30H32N2O10 — CID 3032967
3-carboxy-3,5-dihydroxy-5-oxopentanoate;dimethyl-[2-[4-[(Z)-2-nitro-1,2-diphenylethenyl]phenoxy]ethyl]azanium (PubChem CID 3032967) has the molecular formula C30H32N2O10 and a molecular weight of 580.59 g/mol. Its IUPAC name is 3-carboxy-3,5-dihydroxy-5-oxopentanoate;dimethyl-[2-[4-[(Z)-2-nitro-1,2-diphenylethenyl]phenoxy]ethyl]azanium.
| Compound Name | 3-carboxy-3,5-dihydroxy-5-oxopentanoate;dimethyl-[2-[4-[(Z)-2-nitro-1,2-diphenylethenyl]phenoxy]ethyl]azanium |
|---|---|
| PubChem CID | 3032967 |
| Molecular Formula | C30H32N2O10 |
| Molecular Weight | 580.59 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | 3-carboxy-3,5-dihydroxy-5-oxopentanoate;dimethyl-[2-[4-[(Z)-2-nitro-1,2-diphenylethenyl]phenoxy]ethyl]azanium |
| SMILES | C[NH+](C)CCOc1ccc(/C(=C(/c2ccccc2)[N+](=O)[O-])c2ccccc2)cc1.O=C([O-])CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C24H24N2O3.C6H8O7/c1-25(2)17-18-29-22-15-13-20(14-16-22)23(19-9-5-3-6-10-19)24(26(27)28)21-11-7-4-8-12-21;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-16H,17-18H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/b24-23-; |
| InChIKey | BXPYIGYEBLKLDU-DCXSSQDFSA-N |
| XLogP | 0.82 |
| TPSA | 191.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.59 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|