C20H23NO6 — CID 3084253
but-2-enedioic acid;N,N-dimethyl-2,2-diphenoxyethanamine (PubChem CID 3084253) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is but-2-enedioic acid;N,N-dimethyl-2,2-diphenoxyethanamine.
| Compound Name | but-2-enedioic acid;N,N-dimethyl-2,2-diphenoxyethanamine |
|---|---|
| PubChem CID | 3084253 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | but-2-enedioic acid;N,N-dimethyl-2,2-diphenoxyethanamine |
| SMILES | CN(C)CC(Oc1ccccc1)Oc1ccccc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C16H19NO2.C4H4O4/c1-17(2)13-16(18-14-9-5-3-6-10-14)19-15-11-7-4-8-12-15;5-3(6)1-2-4(7)8/h3-12,16H,13H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | CSQUJXBMSDQIKM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|