C21H24ClNO6 — CID 6445280
(Z)-but-2-enedioic acid;2-[2-(4-chlorophenoxy)phenoxy]-N,N-dimethylpropan-1-amine (PubChem CID 6445280) has the molecular formula C21H24ClNO6 and a molecular weight of 421.88 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-[2-(4-chlorophenoxy)phenoxy]-N,N-dimethylpropan-1-amine.
| Compound Name | (Z)-but-2-enedioic acid;2-[2-(4-chlorophenoxy)phenoxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 6445280 |
| Molecular Formula | C21H24ClNO6 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-[2-(4-chlorophenoxy)phenoxy]-N,N-dimethylpropan-1-amine |
| SMILES | CC(CN(C)C)Oc1ccccc1Oc1ccc(Cl)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C17H20ClNO2.C4H4O4/c1-13(12-19(2)3)20-16-6-4-5-7-17(16)21-15-10-8-14(18)9-11-15;5-3(6)1-2-4(7)8/h4-11,13H,12H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | XQGPGEHENJTLHA-BTJKTKAUSA-N |
| XLogP | 4.17 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|