About pyridin-3-ylmethyl 2-[2-(4-chlorophenoxy)phenoxy]propanoate
pyridin-3-ylmethyl 2-[2-(4-chlorophenoxy)phenoxy]propanoate (PubChem CID 21498253) has the molecular formula C21H18ClNO4
and a molecular weight of 383.83 g/mol. Its IUPAC name is pyridin-3-ylmethyl 2-[2-(4-chlorophenoxy)phenoxy]propanoate.
Molecular Properties
| Compound Name | pyridin-3-ylmethyl 2-[2-(4-chlorophenoxy)phenoxy]propanoate |
| PubChem CID | 21498253 |
| Molecular Formula | C21H18ClNO4 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | pyridin-3-ylmethyl 2-[2-(4-chlorophenoxy)phenoxy]propanoate |
| SMILES | CC(Oc1ccccc1Oc1ccc(Cl)cc1)C(=O)OCc1cccnc1 |
| InChI | InChI=1S/C21H18ClNO4/c1-15(21(24)25-14-16-5-4-12-23-13-16)26-19-6-2-3-7-20(19)27-18-10-8-17(22)9-11-18/h2-13,15H,14H2,1H3 |
| InChIKey | PNVJSWGUPADAKF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pyridin-3-ylmethyl 2-[2-(4-chlorophenoxy)phenoxy]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-ylmethyl 2-[2-(4-chlorophenoxy)phenoxy]propanoate?
The IUPAC name of pyridin-3-ylmethyl 2-[2-(4-chlorophenoxy)phenoxy]propanoate (CID 21498253) is pyridin-3-ylmethyl 2-[2-(4-chlorophenoxy)phenoxy]propanoate.
What is the SMILES notation for pyridin-3-ylmethyl 2-[2-(4-chlorophenoxy)phenoxy]propanoate?
The canonical SMILES for pyridin-3-ylmethyl 2-[2-(4-chlorophenoxy)phenoxy]propanoate is CC(Oc1ccccc1Oc1ccc(Cl)cc1)C(=O)OCc1cccnc1.
What is the InChIKey of pyridin-3-ylmethyl 2-[2-(4-chlorophenoxy)phenoxy]propanoate?
The InChIKey is PNVJSWGUPADAKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18ClNO4/c1-15(21(24)25-14-16-5-4-12-23-13-16)26-19-6-2-3-7-20(19)27-18-10-8-17(22)9-11-18/h2-13,15H,14H2,1H3.
What are the key properties of pyridin-3-ylmethyl 2-[2-(4-chlorophenoxy)phenoxy]propanoate?
pyridin-3-ylmethyl 2-[2-(4-chlorophenoxy)phenoxy]propanoate has a molecular weight of 383.83 g/mol, XLogP of 5.04, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-ylmethyl 2-[2-(4-chlorophenoxy)phenoxy]propanoate is sourced from PubChem (CID 21498253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).