C21H25NO6 — CID 134120171
(E)-but-2-enedioic acid;N,2-dimethyl-3-(2-phenoxyphenoxy)propan-1-amine (PubChem CID 134120171) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N,2-dimethyl-3-(2-phenoxyphenoxy)propan-1-amine.
| Compound Name | (E)-but-2-enedioic acid;N,2-dimethyl-3-(2-phenoxyphenoxy)propan-1-amine |
|---|---|
| PubChem CID | 134120171 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (E)-but-2-enedioic acid;N,2-dimethyl-3-(2-phenoxyphenoxy)propan-1-amine |
| SMILES | CNCC(C)COc1ccccc1Oc1ccccc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H21NO2.C4H4O4/c1-14(12-18-2)13-19-16-10-6-7-11-17(16)20-15-8-4-3-5-9-15;5-3(6)1-2-4(7)8/h3-11,14,18H,12-13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | UIWQNGLFWSPUIX-WLHGVMLRSA-N |
| XLogP | 3.42 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|