C32H47N3O7 — CID 12941102
(E)-but-2-enedioic acid;(2S)-1-[2-[6-(4-phenylpiperazin-1-yl)hexoxy]phenoxy]-3-(propan-2-ylamino)propan-2-ol (PubChem CID 12941102) has the molecular formula C32H47N3O7 and a molecular weight of 585.74 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(2S)-1-[2-[6-(4-phenylpiperazin-1-yl)hexoxy]phenoxy]-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | (E)-but-2-enedioic acid;(2S)-1-[2-[6-(4-phenylpiperazin-1-yl)hexoxy]phenoxy]-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 12941102 |
| Molecular Formula | C32H47N3O7 |
| Molecular Weight | 585.74 g/mol |
| Exact Mass | 585.34 |
| IUPAC Name | (E)-but-2-enedioic acid;(2S)-1-[2-[6-(4-phenylpiperazin-1-yl)hexoxy]phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NC[C@H](O)COc1ccccc1OCCCCCCN1CCN(c2ccccc2)CC1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C28H43N3O3.C4H4O4/c1-24(2)29-22-26(32)23-34-28-15-9-8-14-27(28)33-21-11-4-3-10-16-30-17-19-31(20-18-30)25-12-6-5-7-13-25;5-3(6)1-2-4(7)8/h5-9,12-15,24,26,29,32H,3-4,10-11,16-23H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t26-;/m0./s1 |
| InChIKey | RFKKIOYVJQDSJT-PAYPZWQNSA-N |
| XLogP | 3.90 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.74 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|