C29H45N3O6S — CID 20535147
6-[2-(2-hydroxypropoxy)phenoxy]-1-(4-phenylpiperazin-1-yl)hexan-1-one;N-propan-2-ylmethanesulfonamide (PubChem CID 20535147) has the molecular formula C29H45N3O6S and a molecular weight of 563.76 g/mol. Its IUPAC name is 6-[2-(2-hydroxypropoxy)phenoxy]-1-(4-phenylpiperazin-1-yl)hexan-1-one;N-propan-2-ylmethanesulfonamide.
| Compound Name | 6-[2-(2-hydroxypropoxy)phenoxy]-1-(4-phenylpiperazin-1-yl)hexan-1-one;N-propan-2-ylmethanesulfonamide |
|---|---|
| PubChem CID | 20535147 |
| Molecular Formula | C29H45N3O6S |
| Molecular Weight | 563.76 g/mol |
| Exact Mass | 563.30 |
| IUPAC Name | 6-[2-(2-hydroxypropoxy)phenoxy]-1-(4-phenylpiperazin-1-yl)hexan-1-one;N-propan-2-ylmethanesulfonamide |
| SMILES | CC(C)NS(C)(=O)=O.CC(O)COc1ccccc1OCCCCCC(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H34N2O4.C4H11NO2S/c1-21(28)20-31-24-13-8-7-12-23(24)30-19-9-3-6-14-25(29)27-17-15-26(16-18-27)22-10-4-2-5-11-22;1-4(2)5-8(3,6)7/h2,4-5,7-8,10-13,21,28H,3,6,9,14-20H2,1H3;4-5H,1-3H3 |
| InChIKey | OYMDWWSYYGYOBK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.76 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|