C33H45N3O11 — CID 12941090
bis((Z)-but-2-enedioic acid);(2S)-1-(tert-butylamino)-3-[4-[2-(4-phenylpiperazin-1-yl)ethoxy]phenoxy]propan-2-ol (PubChem CID 12941090) has the molecular formula C33H45N3O11 and a molecular weight of 659.73 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);(2S)-1-(tert-butylamino)-3-[4-[2-(4-phenylpiperazin-1-yl)ethoxy]phenoxy]propan-2-ol.
| Compound Name | bis((Z)-but-2-enedioic acid);(2S)-1-(tert-butylamino)-3-[4-[2-(4-phenylpiperazin-1-yl)ethoxy]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 12941090 |
| Molecular Formula | C33H45N3O11 |
| Molecular Weight | 659.73 g/mol |
| Exact Mass | 659.31 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);(2S)-1-(tert-butylamino)-3-[4-[2-(4-phenylpiperazin-1-yl)ethoxy]phenoxy]propan-2-ol |
| SMILES | CC(C)(C)NC[C@H](O)COc1ccc(OCCN2CCN(c3ccccc3)CC2)cc1.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C25H37N3O3.2C4H4O4/c1-25(2,3)26-19-22(29)20-31-24-11-9-23(10-12-24)30-18-17-27-13-15-28(16-14-27)21-7-5-4-6-8-21;2*5-3(6)1-2-4(7)8/h4-12,22,26,29H,13-20H2,1-3H3;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1-/t22-;;/m0../s1 |
| InChIKey | NCJUGGFPENJIKE-JGUGLKNZSA-N |
| XLogP | 2.44 |
| TPSA | 206.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.73 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|