About 2-phenoxybenzoic acid;propan-2-ol
2-phenoxybenzoic acid;propan-2-ol (PubChem CID 159883753) has the molecular formula C16H18O4
and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-phenoxybenzoic acid;propan-2-ol.
Molecular Properties
| Compound Name | 2-phenoxybenzoic acid;propan-2-ol |
| PubChem CID | 159883753 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-phenoxybenzoic acid;propan-2-ol |
| SMILES | CC(C)O.O=C(O)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C13H10O3.C3H8O/c14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10;1-3(2)4/h1-9H,(H,14,15);3-4H,1-2H3 |
| InChIKey | NTWFFPTTZYHTDU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenoxybenzoic acid;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenoxybenzoic acid;propan-2-ol?
The IUPAC name of 2-phenoxybenzoic acid;propan-2-ol (CID 159883753) is 2-phenoxybenzoic acid;propan-2-ol.
What is the SMILES notation for 2-phenoxybenzoic acid;propan-2-ol?
The canonical SMILES for 2-phenoxybenzoic acid;propan-2-ol is CC(C)O.O=C(O)c1ccccc1Oc1ccccc1.
What is the InChIKey of 2-phenoxybenzoic acid;propan-2-ol?
The InChIKey is NTWFFPTTZYHTDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O3.C3H8O/c14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10;1-3(2)4/h1-9H,(H,14,15);3-4H,1-2H3.
What are the key properties of 2-phenoxybenzoic acid;propan-2-ol?
2-phenoxybenzoic acid;propan-2-ol has a molecular weight of 274.32 g/mol, XLogP of 3.56, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxybenzoic acid;propan-2-ol is sourced from PubChem (CID 159883753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).