C18H24N2O2 — CID 154392461
N'-(2,2-diphenoxyethyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 154392461) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N'-(2,2-diphenoxyethyl)-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-(2,2-diphenoxyethyl)-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 154392461 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N'-(2,2-diphenoxyethyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNCCN(C)CC(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C18H24N2O2/c1-19-13-14-20(2)15-18(21-16-9-5-3-6-10-16)22-17-11-7-4-8-12-17/h3-12,18-19H,13-15H2,1-2H3 |
| InChIKey | XITPDBKFPAWWLL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|