C16H21NO2 — CID 40579720
(2S)-2-phenoxy-N,N-bis(prop-2-enyl)butanamide (PubChem CID 40579720) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (2S)-2-phenoxy-N,N-bis(prop-2-enyl)butanamide.
| Compound Name | (2S)-2-phenoxy-N,N-bis(prop-2-enyl)butanamide |
|---|---|
| PubChem CID | 40579720 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (2S)-2-phenoxy-N,N-bis(prop-2-enyl)butanamide |
| SMILES | C=CCN(CC=C)C(=O)[C@H](CC)Oc1ccccc1 |
| InChI | InChI=1S/C16H21NO2/c1-4-12-17(13-5-2)16(18)15(6-3)19-14-10-8-7-9-11-14/h4-5,7-11,15H,1-2,6,12-13H2,3H3/t15-/m0/s1 |
| InChIKey | UXHZEPNTKPDSAN-HNNXBMFYSA-N |
| XLogP | 3.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|