C18H29NO2 — CID 3492483
N,N-dibutyl-2-phenoxybutanamide (PubChem CID 3492483) has the molecular formula C18H29NO2 and a molecular weight of 291.43 g/mol. Its IUPAC name is N,N-dibutyl-2-phenoxybutanamide.
| Compound Name | N,N-dibutyl-2-phenoxybutanamide |
|---|---|
| PubChem CID | 3492483 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.43 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | N,N-dibutyl-2-phenoxybutanamide |
| SMILES | CCCCN(CCCC)C(=O)C(CC)Oc1ccccc1 |
| InChI | InChI=1S/C18H29NO2/c1-4-7-14-19(15-8-5-2)18(20)17(6-3)21-16-12-10-9-11-13-16/h9-13,17H,4-8,14-15H2,1-3H3 |
| InChIKey | ODGZRIDZXNVTDY-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |