C14H20FNO2 — CID 94016182
(2S)-N,N-diethyl-2-(4-fluorophenoxy)butanamide (PubChem CID 94016182) has the molecular formula C14H20FNO2 and a molecular weight of 253.32 g/mol. Its IUPAC name is (2S)-N,N-diethyl-2-(4-fluorophenoxy)butanamide.
| Compound Name | (2S)-N,N-diethyl-2-(4-fluorophenoxy)butanamide |
|---|---|
| PubChem CID | 94016182 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (2S)-N,N-diethyl-2-(4-fluorophenoxy)butanamide |
| SMILES | CC[C@H](Oc1ccc(F)cc1)C(=O)N(CC)CC |
| InChI | InChI=1S/C14H20FNO2/c1-4-13(14(17)16(5-2)6-3)18-12-9-7-11(15)8-10-12/h7-10,13H,4-6H2,1-3H3/t13-/m0/s1 |
| InChIKey | HQRBIENDTSSIMT-ZDUSSCGKSA-N |
| XLogP | 2.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |