C20H24O2S2 — CID 10666256
S-phenyl (2S,3S,4R)-3-hydroxy-2,4-dimethyl-4-phenylsulfanylhexanethioate (PubChem CID 10666256) has the molecular formula C20H24O2S2 and a molecular weight of 360.54 g/mol. Its IUPAC name is S-phenyl (2S,3S,4R)-3-hydroxy-2,4-dimethyl-4-phenylsulfanylhexanethioate.
| Compound Name | S-phenyl (2S,3S,4R)-3-hydroxy-2,4-dimethyl-4-phenylsulfanylhexanethioate |
|---|---|
| PubChem CID | 10666256 |
| Molecular Formula | C20H24O2S2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | S-phenyl (2S,3S,4R)-3-hydroxy-2,4-dimethyl-4-phenylsulfanylhexanethioate |
| SMILES | CC[C@@](C)(Sc1ccccc1)[C@@H](O)[C@H](C)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C20H24O2S2/c1-4-20(3,24-17-13-9-6-10-14-17)18(21)15(2)19(22)23-16-11-7-5-8-12-16/h5-15,18,21H,4H2,1-3H3/t15-,18-,20+/m0/s1 |
| InChIKey | SUJQYGDWGPLYBG-ZAAXVRCTSA-N |
| XLogP | 5.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|