C13H15F3O2S — CID 101245685
S-phenyl (2S,3R)-3-hydroxy-2-(trifluoromethyl)hexanethioate (PubChem CID 101245685) has the molecular formula C13H15F3O2S and a molecular weight of 292.32 g/mol. Its IUPAC name is S-phenyl (2S,3R)-3-hydroxy-2-(trifluoromethyl)hexanethioate.
| Compound Name | S-phenyl (2S,3R)-3-hydroxy-2-(trifluoromethyl)hexanethioate |
|---|---|
| PubChem CID | 101245685 |
| Molecular Formula | C13H15F3O2S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | S-phenyl (2S,3R)-3-hydroxy-2-(trifluoromethyl)hexanethioate |
| SMILES | CCC[C@@H](O)[C@H](C(=O)Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H15F3O2S/c1-2-6-10(17)11(13(14,15)16)12(18)19-9-7-4-3-5-8-9/h3-5,7-8,10-11,17H,2,6H2,1H3/t10-,11-/m1/s1 |
| InChIKey | WPPSQBKAYPYUHB-GHMZBOCLSA-N |
| XLogP | 3.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|