C16H13F3O2S — CID 101245675
S-phenyl (2S)-3,3,3-trifluoro-2-[(R)-hydroxy(phenyl)methyl]propanethioate (PubChem CID 101245675) has the molecular formula C16H13F3O2S and a molecular weight of 326.34 g/mol. Its IUPAC name is S-phenyl (2S)-3,3,3-trifluoro-2-[(R)-hydroxy(phenyl)methyl]propanethioate.
| Compound Name | S-phenyl (2S)-3,3,3-trifluoro-2-[(R)-hydroxy(phenyl)methyl]propanethioate |
|---|---|
| PubChem CID | 101245675 |
| Molecular Formula | C16H13F3O2S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | S-phenyl (2S)-3,3,3-trifluoro-2-[(R)-hydroxy(phenyl)methyl]propanethioate |
| SMILES | O=C(Sc1ccccc1)[C@@H]([C@@H](O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H13F3O2S/c17-16(18,19)13(14(20)11-7-3-1-4-8-11)15(21)22-12-9-5-2-6-10-12/h1-10,13-14,20H/t13-,14+/m1/s1 |
| InChIKey | PZEABEFKRGGTMI-KGLIPLIRSA-N |
| XLogP | 4.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|