C17H15F3O2S — CID 101245677
S-phenyl (2S)-3,3,3-trifluoro-2-[(R)-hydroxy-(4-methylphenyl)methyl]propanethioate (PubChem CID 101245677) has the molecular formula C17H15F3O2S and a molecular weight of 340.37 g/mol. Its IUPAC name is S-phenyl (2S)-3,3,3-trifluoro-2-[(R)-hydroxy-(4-methylphenyl)methyl]propanethioate.
| Compound Name | S-phenyl (2S)-3,3,3-trifluoro-2-[(R)-hydroxy-(4-methylphenyl)methyl]propanethioate |
|---|---|
| PubChem CID | 101245677 |
| Molecular Formula | C17H15F3O2S |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | S-phenyl (2S)-3,3,3-trifluoro-2-[(R)-hydroxy-(4-methylphenyl)methyl]propanethioate |
| SMILES | Cc1ccc([C@H](O)[C@H](C(=O)Sc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15F3O2S/c1-11-7-9-12(10-8-11)15(21)14(17(18,19)20)16(22)23-13-5-3-2-4-6-13/h2-10,14-15,21H,1H3/t14-,15+/m1/s1 |
| InChIKey | OCVOFNZNSVXANU-CABCVRRESA-N |
| XLogP | 4.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|