About (4S)-5-hydroxy-2,2-dimethyl-1,7-diphenyl-4-(trifluoromethyl)heptan-3-one
(4S)-5-hydroxy-2,2-dimethyl-1,7-diphenyl-4-(trifluoromethyl)heptan-3-one (PubChem CID 101358224) has the molecular formula C22H25F3O2
and a molecular weight of 378.43 g/mol. Its IUPAC name is (4S)-5-hydroxy-2,2-dimethyl-1,7-diphenyl-4-(trifluoromethyl)heptan-3-one.
Molecular Properties
| Compound Name | (4S)-5-hydroxy-2,2-dimethyl-1,7-diphenyl-4-(trifluoromethyl)heptan-3-one |
| PubChem CID | 101358224 |
| Molecular Formula | C22H25F3O2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (4S)-5-hydroxy-2,2-dimethyl-1,7-diphenyl-4-(trifluoromethyl)heptan-3-one |
| SMILES | CC(C)(Cc1ccccc1)C(=O)[C@H](C(O)CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H25F3O2/c1-21(2,15-17-11-7-4-8-12-17)20(27)19(22(23,24)25)18(26)14-13-16-9-5-3-6-10-16/h3-12,18-19,26H,13-15H2,1-2H3/t18?,19-/m0/s1 |
| InChIKey | YYILIBZNODARFL-GGYWPGCISA-N |
| XLogP | 5.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-5-hydroxy-2,2-dimethyl-1,7-diphenyl-4-(trifluoromethyl)heptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-5-hydroxy-2,2-dimethyl-1,7-diphenyl-4-(trifluoromethyl)heptan-3-one?
The IUPAC name of (4S)-5-hydroxy-2,2-dimethyl-1,7-diphenyl-4-(trifluoromethyl)heptan-3-one (CID 101358224) is (4S)-5-hydroxy-2,2-dimethyl-1,7-diphenyl-4-(trifluoromethyl)heptan-3-one.
What is the SMILES notation for (4S)-5-hydroxy-2,2-dimethyl-1,7-diphenyl-4-(trifluoromethyl)heptan-3-one?
The canonical SMILES for (4S)-5-hydroxy-2,2-dimethyl-1,7-diphenyl-4-(trifluoromethyl)heptan-3-one is CC(C)(Cc1ccccc1)C(=O)[C@H](C(O)CCc1ccccc1)C(F)(F)F.
What is the InChIKey of (4S)-5-hydroxy-2,2-dimethyl-1,7-diphenyl-4-(trifluoromethyl)heptan-3-one?
The InChIKey is YYILIBZNODARFL-GGYWPGCISA-N. The full InChI is InChI=1S/C22H25F3O2/c1-21(2,15-17-11-7-4-8-12-17)20(27)19(22(23,24)25)18(26)14-13-16-9-5-3-6-10-16/h3-12,18-19,26H,13-15H2,1-2H3/t18?,19-/m0/s1.
What are the key properties of (4S)-5-hydroxy-2,2-dimethyl-1,7-diphenyl-4-(trifluoromethyl)heptan-3-one?
(4S)-5-hydroxy-2,2-dimethyl-1,7-diphenyl-4-(trifluoromethyl)heptan-3-one has a molecular weight of 378.43 g/mol, XLogP of 5.00, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-5-hydroxy-2,2-dimethyl-1,7-diphenyl-4-(trifluoromethyl)heptan-3-one is sourced from PubChem (CID 101358224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).