C21H26O3 — CID 11221099
(2R,3S)-3-hydroxy-2-[(1R)-1-hydroxy-3-phenylpropyl]-1-phenylhexan-1-one (PubChem CID 11221099) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-2-[(1R)-1-hydroxy-3-phenylpropyl]-1-phenylhexan-1-one.
| Compound Name | (2R,3S)-3-hydroxy-2-[(1R)-1-hydroxy-3-phenylpropyl]-1-phenylhexan-1-one |
|---|---|
| PubChem CID | 11221099 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (2R,3S)-3-hydroxy-2-[(1R)-1-hydroxy-3-phenylpropyl]-1-phenylhexan-1-one |
| SMILES | CCC[C@H](O)[C@@H](C(=O)c1ccccc1)[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C21H26O3/c1-2-9-18(22)20(21(24)17-12-7-4-8-13-17)19(23)15-14-16-10-5-3-6-11-16/h3-8,10-13,18-20,22-23H,2,9,14-15H2,1H3/t18-,19+,20+/m0/s1 |
| InChIKey | MSDHRQCPQYAYCA-XUVXKRRUSA-N |
| XLogP | 3.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |