C16H18ClNO — CID 66915929
2-amino-1,4-diphenylbutan-1-one;hydrochloride (PubChem CID 66915929) has the molecular formula C16H18ClNO and a molecular weight of 275.78 g/mol. Its IUPAC name is 2-amino-1,4-diphenylbutan-1-one;hydrochloride.
| Compound Name | 2-amino-1,4-diphenylbutan-1-one;hydrochloride |
|---|---|
| PubChem CID | 66915929 |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-amino-1,4-diphenylbutan-1-one;hydrochloride |
| SMILES | Cl.NC(CCc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H17NO.ClH/c17-15(12-11-13-7-3-1-4-8-13)16(18)14-9-5-2-6-10-14;/h1-10,15H,11-12,17H2;1H |
| InChIKey | LDQANSZRIANRIN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |