C20H24OS2 — CID 10043151
(4S)-2-methyl-1,1-bis(phenylsulfanyl)hept-1-en-4-ol (PubChem CID 10043151) has the molecular formula C20H24OS2 and a molecular weight of 344.55 g/mol. Its IUPAC name is (4S)-2-methyl-1,1-bis(phenylsulfanyl)hept-1-en-4-ol.
| Compound Name | (4S)-2-methyl-1,1-bis(phenylsulfanyl)hept-1-en-4-ol |
|---|---|
| PubChem CID | 10043151 |
| Molecular Formula | C20H24OS2 |
| Molecular Weight | 344.55 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (4S)-2-methyl-1,1-bis(phenylsulfanyl)hept-1-en-4-ol |
| SMILES | CCC[C@H](O)CC(C)=C(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C20H24OS2/c1-3-10-17(21)15-16(2)20(22-18-11-6-4-7-12-18)23-19-13-8-5-9-14-19/h4-9,11-14,17,21H,3,10,15H2,1-2H3/t17-/m0/s1 |
| InChIKey | GMXNFCFGBGRRHD-KRWDZBQOSA-N |
| XLogP | 6.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.55 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |