About (3R)-1-phenoxyhexan-3-ol
(3R)-1-phenoxyhexan-3-ol (PubChem CID 102063151) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is (3R)-1-phenoxyhexan-3-ol.
Molecular Properties
| Compound Name | (3R)-1-phenoxyhexan-3-ol |
| PubChem CID | 102063151 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (3R)-1-phenoxyhexan-3-ol |
| SMILES | CCC[C@@H](O)CCOc1ccccc1 |
| InChI | InChI=1S/C12H18O2/c1-2-6-11(13)9-10-14-12-7-4-3-5-8-12/h3-5,7-8,11,13H,2,6,9-10H2,1H3/t11-/m1/s1 |
| InChIKey | JNXJDXPDPIGACZ-LLVKDONJSA-N |
| XLogP | 2.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-1-phenoxyhexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-phenoxyhexan-3-ol?
The IUPAC name of (3R)-1-phenoxyhexan-3-ol (CID 102063151) is (3R)-1-phenoxyhexan-3-ol.
What is the SMILES notation for (3R)-1-phenoxyhexan-3-ol?
The canonical SMILES for (3R)-1-phenoxyhexan-3-ol is CCC[C@@H](O)CCOc1ccccc1.
What is the InChIKey of (3R)-1-phenoxyhexan-3-ol?
The InChIKey is JNXJDXPDPIGACZ-LLVKDONJSA-N. The full InChI is InChI=1S/C12H18O2/c1-2-6-11(13)9-10-14-12-7-4-3-5-8-12/h3-5,7-8,11,13H,2,6,9-10H2,1H3/t11-/m1/s1.
What are the key properties of (3R)-1-phenoxyhexan-3-ol?
(3R)-1-phenoxyhexan-3-ol has a molecular weight of 194.27 g/mol, XLogP of 2.62, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-phenoxyhexan-3-ol is sourced from PubChem (CID 102063151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).