C17H20O3 — CID 5314309
1,5-diphenoxypentan-3-ol (PubChem CID 5314309) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 1,5-diphenoxypentan-3-ol.
| Compound Name | 1,5-diphenoxypentan-3-ol |
|---|---|
| PubChem CID | 5314309 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 1,5-diphenoxypentan-3-ol |
| SMILES | OC(CCOc1ccccc1)CCOc1ccccc1 |
| InChI | InChI=1S/C17H20O3/c18-15(11-13-19-16-7-3-1-4-8-16)12-14-20-17-9-5-2-6-10-17/h1-10,15,18H,11-14H2 |
| InChIKey | KPICWQUQQVAWCC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |