C21H24O2S2 — CID 11111514
S-phenyl (2S,3S)-3-hydroxy-2-methyl-3-(1-phenylsulfanylcyclopentyl)propanethioate (PubChem CID 11111514) has the molecular formula C21H24O2S2 and a molecular weight of 372.56 g/mol. Its IUPAC name is S-phenyl (2S,3S)-3-hydroxy-2-methyl-3-(1-phenylsulfanylcyclopentyl)propanethioate.
| Compound Name | S-phenyl (2S,3S)-3-hydroxy-2-methyl-3-(1-phenylsulfanylcyclopentyl)propanethioate |
|---|---|
| PubChem CID | 11111514 |
| Molecular Formula | C21H24O2S2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | S-phenyl (2S,3S)-3-hydroxy-2-methyl-3-(1-phenylsulfanylcyclopentyl)propanethioate |
| SMILES | C[C@H](C(=O)Sc1ccccc1)[C@H](O)C1(Sc2ccccc2)CCCC1 |
| InChI | InChI=1S/C21H24O2S2/c1-16(20(23)24-17-10-4-2-5-11-17)19(22)21(14-8-9-15-21)25-18-12-6-3-7-13-18/h2-7,10-13,16,19,22H,8-9,14-15H2,1H3/t16-,19-/m0/s1 |
| InChIKey | QXRXOCYYWJTWTN-LPHOPBHVSA-N |
| XLogP | 5.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|