About S-(4-benzoylphenyl) 2,3-dimethylbutanethioate
S-(4-benzoylphenyl) 2,3-dimethylbutanethioate (PubChem CID 144560544) has the molecular formula C19H20O2S
and a molecular weight of 312.43 g/mol. Its IUPAC name is S-(4-benzoylphenyl) 2,3-dimethylbutanethioate.
Molecular Properties
| Compound Name | S-(4-benzoylphenyl) 2,3-dimethylbutanethioate |
| PubChem CID | 144560544 |
| Molecular Formula | C19H20O2S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | S-(4-benzoylphenyl) 2,3-dimethylbutanethioate |
| SMILES | CC(C)C(C)C(=O)Sc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H20O2S/c1-13(2)14(3)19(21)22-17-11-9-16(10-12-17)18(20)15-7-5-4-6-8-15/h4-14H,1-3H3 |
| InChIKey | YIDDWTITAPZYLI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-benzoylphenyl) 2,3-dimethylbutanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-benzoylphenyl) 2,3-dimethylbutanethioate?
The IUPAC name of S-(4-benzoylphenyl) 2,3-dimethylbutanethioate (CID 144560544) is S-(4-benzoylphenyl) 2,3-dimethylbutanethioate.
What is the SMILES notation for S-(4-benzoylphenyl) 2,3-dimethylbutanethioate?
The canonical SMILES for S-(4-benzoylphenyl) 2,3-dimethylbutanethioate is CC(C)C(C)C(=O)Sc1ccc(C(=O)c2ccccc2)cc1.
What is the InChIKey of S-(4-benzoylphenyl) 2,3-dimethylbutanethioate?
The InChIKey is YIDDWTITAPZYLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O2S/c1-13(2)14(3)19(21)22-17-11-9-16(10-12-17)18(20)15-7-5-4-6-8-15/h4-14H,1-3H3.
What are the key properties of S-(4-benzoylphenyl) 2,3-dimethylbutanethioate?
S-(4-benzoylphenyl) 2,3-dimethylbutanethioate has a molecular weight of 312.43 g/mol, XLogP of 4.83, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-benzoylphenyl) 2,3-dimethylbutanethioate is sourced from PubChem (CID 144560544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).