C20H24O2S — CID 144561438
S-(4-formylphenyl) 2,3-dimethylbutanethioate;toluene (PubChem CID 144561438) has the molecular formula C20H24O2S and a molecular weight of 328.48 g/mol. Its IUPAC name is S-(4-formylphenyl) 2,3-dimethylbutanethioate;toluene.
| Compound Name | S-(4-formylphenyl) 2,3-dimethylbutanethioate;toluene |
|---|---|
| PubChem CID | 144561438 |
| Molecular Formula | C20H24O2S |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | S-(4-formylphenyl) 2,3-dimethylbutanethioate;toluene |
| SMILES | CC(C)C(C)C(=O)Sc1ccc(C=O)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C13H16O2S.C7H8/c1-9(2)10(3)13(15)16-12-6-4-11(8-14)5-7-12;1-7-5-3-2-4-6-7/h4-10H,1-3H3;2-6H,1H3 |
| InChIKey | RIPRIGKHPYURSF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|