C12H18O4 — CID 146305712
2-methyl-4-phenoxypentane-1,3,5-triol (PubChem CID 146305712) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-methyl-4-phenoxypentane-1,3,5-triol.
| Compound Name | 2-methyl-4-phenoxypentane-1,3,5-triol |
|---|---|
| PubChem CID | 146305712 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-methyl-4-phenoxypentane-1,3,5-triol |
| SMILES | CC(CO)C(O)C(CO)Oc1ccccc1 |
| InChI | InChI=1S/C12H18O4/c1-9(7-13)12(15)11(8-14)16-10-5-3-2-4-6-10/h2-6,9,11-15H,7-8H2,1H3 |
| InChIKey | PGHAJYAPGQXVPH-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |