C11H14O4S — CID 19756007
O-(1-phenoxyethyl) 2,3-dihydroxypropanethioate (PubChem CID 19756007) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is O-(1-phenoxyethyl) 2,3-dihydroxypropanethioate.
| Compound Name | O-(1-phenoxyethyl) 2,3-dihydroxypropanethioate |
|---|---|
| PubChem CID | 19756007 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | O-(1-phenoxyethyl) 2,3-dihydroxypropanethioate |
| SMILES | CC(OC(=S)C(O)CO)Oc1ccccc1 |
| InChI | InChI=1S/C11H14O4S/c1-8(15-11(16)10(13)7-12)14-9-5-3-2-4-6-9/h2-6,8,10,12-13H,7H2,1H3 |
| InChIKey | DEKVEGRYKAJIMP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|