C18H22O5 — CID 57241098
2-phenoxy-4-(2-phenoxyethoxy)butane-1,3-diol (PubChem CID 57241098) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-phenoxy-4-(2-phenoxyethoxy)butane-1,3-diol.
| Compound Name | 2-phenoxy-4-(2-phenoxyethoxy)butane-1,3-diol |
|---|---|
| PubChem CID | 57241098 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 2-phenoxy-4-(2-phenoxyethoxy)butane-1,3-diol |
| SMILES | OCC(Oc1ccccc1)C(O)COCCOc1ccccc1 |
| InChI | InChI=1S/C18H22O5/c19-13-18(23-16-9-5-2-6-10-16)17(20)14-21-11-12-22-15-7-3-1-4-8-15/h1-10,17-20H,11-14H2 |
| InChIKey | JUSRLGBDENIMSD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|