C18H21O2P — CID 2752007
1-diphenylphosphoryl-3,3-dimethylbutan-2-one (PubChem CID 2752007) has the molecular formula C18H21O2P and a molecular weight of 300.34 g/mol. Its IUPAC name is 1-diphenylphosphoryl-3,3-dimethylbutan-2-one.
| Compound Name | 1-diphenylphosphoryl-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 2752007 |
| Molecular Formula | C18H21O2P |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-diphenylphosphoryl-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21O2P/c1-18(2,3)17(19)14-21(20,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13H,14H2,1-3H3 |
| InChIKey | ZUPMDUCYTDTNKV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|