C24H33O5PSi — CID 173295554
(2R)-3-tert-butyl-2-dimethylsilyloxy-6-diphenylphosphoryl-5-oxohexanoic acid (PubChem CID 173295554) has the molecular formula C24H33O5PSi and a molecular weight of 460.58 g/mol. Its IUPAC name is (2R)-3-tert-butyl-2-dimethylsilyloxy-6-diphenylphosphoryl-5-oxohexanoic acid.
| Compound Name | (2R)-3-tert-butyl-2-dimethylsilyloxy-6-diphenylphosphoryl-5-oxohexanoic acid |
|---|---|
| PubChem CID | 173295554 |
| Molecular Formula | C24H33O5PSi |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | (2R)-3-tert-butyl-2-dimethylsilyloxy-6-diphenylphosphoryl-5-oxohexanoic acid |
| SMILES | C[SiH](C)O[C@@H](C(=O)O)C(CC(=O)CP(=O)(c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H33O5PSi/c1-24(2,3)21(22(23(26)27)29-31(4)5)16-18(25)17-30(28,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-15,21-22,31H,16-17H2,1-5H3,(H,26,27)/t21?,22-/m1/s1 |
| InChIKey | NXZLSDNEHLCXJZ-FOIFJWKZSA-N |
| XLogP | 4.08 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|